71828-14-3
Chemical Structure
Avermectin B1a aglycon
- CAS No.: 71828-14-3
- Formula:C34H48O8
- Molecular Weight:584.74
InChIKey: XLEUIYGDSWMLCR-AOIHNFKZSA-N
SMILES: C[C@H]([C@@]1([H])O[C@]2(C=C[C@@H]1C)C[C@](OC([C@@](C=C3C)([H])[C@]4([C@]([C@@H]3O)([H])OC/C4=C\C=C\[C@@H]5C)O)=O)([H])C[C@](C/C=C([C@H]5O)\C)([H])O2)CC
Biological Activity: Avermectin B1a aglycon is an aglycone derivative of Avermectin B1a (HY-15308), an antiparasitic agent that paralyzes nematodes. Avermectin B1a aglycon hyperpolarizes P. crassipes muscle fibers, with a minimum effective concentration of 0.1 μM[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Avermectin B1a aglycon | Avermectin B1a aglycon is an aglycone derivative of Avermectin B1a (HY-15308), an antiparasitic agent that paralyzes nematodes. Avermectin B1a aglycon hyperpolarizes P. crassipes muscle fibers, with a minimum effective concentration of 0.1 μM. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||