73793-68-7
Chemical Structure
Kihadanin B
- CAS No.: 73793-68-7
- Formula:C26H30O9
- Molecular Weight:486.51
IUPAC Name: (1R,3aS,4aR,4bR,6aR,11aR,11bR,13aS)-1-(5-hydroxy-2-oxo-2,5-dihydrofuran-3-yl)-4b,7,7,11a,13a-pentamethyl-1,6a,7,11a,11b,12,13,13a-octahydrooxepino[4',3':3,4]benzo[1,2-f]oxireno[2,3-d]isochromene-3,5,9(3aH,4bH,6H)-trione
InChIKey: LUSHRJRLUBDDTB-KNQGVANASA-N
SMILES: C[C@]12[C@]34[C@@H](C(O[C@@H](C5=CC(O)OC5=O)[C@@]4(CC[C@]1([H])[C@@]6([C@@](C(C)(OC(C=C6)=O)C)([H])CC2=O)C)C)=O)O3
Biological Activity: Kihadanin B is a citrus limonoid that can be purified from the peels of immature Citrus unshiu. Kihadanin B suppresses adipogenesis through repression of the Akt-FOXO1-PPARγ axis in 3T3-L1 adipocytes[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Kihadanin B | Kihadanin B is a citrus limonoid that can be purified from the peels of immature Citrus unshiu. Kihadanin B suppresses adipogenesis through repression of the Akt-FOXO1-PPARγ axis in 3T3-L1 adipocytes. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||