74228-81-2
Chemical Structure
N-Formylfortimicin A
Synonym(s): SF-1854
- CAS No.: 74228-81-2
- Formula:C18H35N5O7
- Molecular Weight:433.50
IUPAC Name: N-(4-amino-3-((3-amino-6-(1-aminoethyl)tetrahydro-2H-pyran-2-yl)oxy)-2,5-dihydroxy-6-methoxycyclohexyl)-2-formamido-N-methylacetamide
InChIKey: YUNDUWUJKWLLGE-UHFFFAOYSA-N
SMILES: O[C@@H]1[C@H](N(C(CNC=O)=O)C)[C@@H](OC)[C@@H](O)[C@H](N)[C@H]1O[C@@H]2[C@@H](CC[C@@]([C@H](C)N)(O2)[H])N
Biological Activity: N-Formylfortimicin A (SF-1854) is an aminoglycoside antibiotic with broad-spectrum antibacterial activity. It primarily acts on bacterial ribosomes to inhibit protein synthesis and exhibits notable inhibitory effects against various Gram-positive and Gram-negative bacteria (e.g., E. coli with a MIC of 12.5-50 μg/mL), making it a potential candidate for research on bacterial infection-related diseases[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N-Formylfortimicin A | N-Formylfortimicin A (SF-1854) is an aminoglycoside antibiotic with broad-spectrum antibacterial activity. It primarily acts on bacterial ribosomes to inhibit protein synthesis and exhibits notable inhibitory effects against various Gram-positive and Gram-negative bacteria (e.g., E. coli with a MIC of 12.5-50 μg/mL), making it a potential candidate for research on bacterial infection-related diseases. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
