74805-91-7
Chemical Structure
Methylophiopogonanone B
- CAS No.: 74805-91-7
- Formula:C19H20O5
- Molecular Weight:328.36
IUPAC Name: (R)-5,7-dihydroxy-3-(4-methoxybenzyl)-6,8-dimethylchroman-4-one
InChIKey: UFMAZRUMVFVHLY-CYBMUJFWSA-N
SMILES: O=C1[C@H](CC2=CC=C(OC)C=C2)COC3=C(C)C(O)=C(C)C(O)=C13
Biological Activity: Methylophiopogonanone B is a homoisoflavonoid compound. Methylophiopogonanone B can be isolated from O. japonicus root. Methylophiopogonanone B promotes Rho activation and Tubulin depolymerization. Methylophiopogonanone B significantly increases GTP-Rho, but not GTP-Rac or GTP-CDC42. Methylophiopogonanone B induces cell morphological change via melanocyte dendrite retraction and stress fiber formation. Methylophiopogonanone B exhibits strong antioxidant activity. Methylophiopogonanone B can be used in the research of cervical cancer[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Methylophiopogonanone B | 99.84% | Methylophiopogonanone B is a homoisoflavonoid compound. Methylophiopogonanone B can be isolated from O. japonicus root. Methylophiopogonanone B promotes Rho activation and Tubulin depolymerization. Methylophiopogonanone B significantly increases GTP-Rho, but not GTP-Rac or GTP-CDC42. Methylophiopogonanone B induces cell morphological change via melanocyte dendrite retraction and stress fiber formation. Methylophiopogonanone B exhibits strong antioxidant activity. Methylophiopogonanone B can be used in the research of cervical cancer. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Wang Y, et al. Homoisoflavonoids and the Antioxidant Activity of Ophiopogon japonicus Root. Iran J Pharm Res. 2017 Winter;16(1):357-365. [Content Brief]
- [2]. Ito Y, et al. A novel agent, methylophiopogonanone B, promotes Rho activation and tubulin depolymerization. Mol Cell Biochem. 2007;297(1-2):121-129. [Content Brief]
Keywords
