77210-33-4
Chemical Structure
Trichilin B
- CAS No.: 77210-33-4
- Formula:C34H44O13
- Molecular Weight:660.71
InChIKey: ZNMIEELSTHBHDT-KRUJTDOQSA-N
SMILES: O=C(O[C@@H]1[C@H](O)[C@@]23CO[C@H](OC(C(C)CC)=O)[C@@](C2C[C@@H](O)[C@]4(C)[C@@]3(C([C@H](O)[C@@]5(C)[C@H](C6=COC=C6)C[C@H]7O[C@]754)=O)[H])([H])[C@@H]1OC(C)=O)C
Biological Activity: Trichilin B is a limonoid compound found in the twigs and leaves of Trichilia connaroides. Trichilin B exhibits no in vitro cytotoxic activity against tumor cell lines[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Trichilin B | Trichilin B is a limonoid compound found in the twigs and leaves of Trichilia connaroides. Trichilin B exhibits no in vitro cytotoxic activity against tumor cell lines. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||