79514-43-5
Chemical Structure
NSC-323241
- CAS No.: 79514-43-5
- Formula:C16H22N4Se
- Molecular Weight:349.33
SMILES: C/C(C1=CC=CC=N1)=N\NC(N2CC3CCC(CC3)C2)=[Se]
Biological Activity: NSC-323241 is a potent STT3A-mediated mega protein complex assembly inhibitor. NSC-323241 disrupts he endoplasmic reticulum (ER) mega complex nucleated by STT3A during dengue virus (DENV) and Zika virus (ZIKV) infection. NSC-323241 targets the binding of STT3A subcomplex with viral nonstructural proteins (e.g., NS2B, NS3) and host translocon proteins, disrupting the formation of viral replication microenvironment. NSC-323241 is promising for research of flavivirus infection, such as dengue fever and Zika virus[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
NSC-323241 | NSC-323241 is a potent STT3A-mediated mega protein complex assembly inhibitor. NSC-323241 disrupts he endoplasmic reticulum (ER) mega complex nucleated by STT3A during dengue virus (DENV) and Zika virus (ZIKV) infection. NSC-323241 targets the binding of STT3A subcomplex with viral nonstructural proteins (e.g., NS2B, NS3) and host translocon proteins, disrupting the formation of viral replication microenvironment. NSC-323241 is promising for research of flavivirus infection, such as dengue fever and Zika virus. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
