79541-46-1
Chemical Structure
4-Azidophlorizin
- CAS No.: 79541-46-1
- Formula:C21H23N3O9
- Molecular Weight:461.42
IUPAC Name: 3-(4-azidophenyl)-1-(2,4-dihydroxy-6-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)phenyl)propan-1-one
InChIKey: AXCDEMZKQHNYNE-QNDFHXLGSA-N
SMILES: [N-]=[N+]=NC(C=C1)=CC=C1CCC(C2=C(C=C(C=C2O)O)O[C@@H]3O[C@@H]([C@H]([C@@H]([C@H]3O)O)O)CO)=O
Biological Activity: 4-Azidophlorizin is a high affinity probe and photoaffinity label for the glucose transporter in brush border membranes[1]. 4-Azidophlorizin is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
4-Azidophlorizin | 4-Azidophlorizin is a high affinity probe and photoaffinity label for the glucose transporter in brush border membranes. 4-Azidophlorizin is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
