799268-69-2
Chemical Structure
C18:1 Cyclic LPA
- CAS No.: 799268-69-2
- Formula:C21H44NO5P
- Molecular Weight:421.55
InChIKey: OQYRMQWRTNWOER-WBIWQBECSA-N
SMILES: CCCCCCCC/C=C\CCCCCCCCOC[C@H]1OP(O)(OC1)=O.N
Biological Activity: C18:1 Cyclic LPA is a naturally occurring analog of the growth factor-like phospholipid mediator, lysophosphatidic acid (LPA), characterized by the formation of a 5-membered ring between its sn-2 hydroxy group and the sn-3 phosphate. This unique structure allows C18:1 Cyclic LPA to influence a variety of cellular functions, such as inhibiting cell cycle progression, promoting the formation of stress fibers, curtailing tumor cell invasiveness and metastasis, and modulating the differentiation and survival of neuronal cells. Notably, many of these cellular effects elicited by C18:1 Cyclic LPA appear to counter those induced by LPA, despite the activation of seemingly similar receptor populations.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
C18:1 Cyclic LPA | 99% | C18:1 Cyclic LPA is a naturally occurring analog of the growth factor-like phospholipid mediator, lysophosphatidic acid (LPA), characterized by the formation of a 5-membered ring between its sn-2 hydroxy group and the sn-3 phosphate. This unique structure allows C18:1 Cyclic LPA to influence a variety of cellular functions, such as inhibiting cell cycle progression, promoting the formation of stress fibers, curtailing tumor cell invasiveness and metastasis, and modulating the differentiation and survival of neuronal cells. Notably, many of these cellular effects elicited by C18:1 Cyclic LPA appear to counter those induced by LPA, despite the activation of seemingly similar receptor populations. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
