79982-82-4
Chemical Structure
Fenretinide glucuronide
Synonym(s): 4-HPR-O-glucuronide
- CAS No.: 79982-82-4
- Formula:C32H41NO8
- Molecular Weight:567.67
InChIKey: UVITUJIIRZWOPU-QLTZMECOSA-N
SMILES: OC([C@H]([C@H]([C@@H]([C@H]1O)O)O)O[C@H]1OC2=CC=C(C=C2)NC(/C=C(C)/C=C/C=C(C)/C=C/C3=C(C)CCCC3(C)C)=O)=O
Biological Activity: Fenretinide glucuronide (4-HPR-O-glucuronide) is a metabolite formed from Fenretinide (HY-15373) through glucuronidation. The formation of Fenretinide glucuronide enhances the water solubility of Fenretinide and facilitates its excretion. Fenretinide glucuronide holds potential for research in the field of cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Fenretinide glucuronide | Fenretinide glucuronide (4-HPR-O-glucuronide) is a metabolite formed from Fenretinide (HY-15373) through glucuronidation. The formation of Fenretinide glucuronide enhances the water solubility of Fenretinide and facilitates its excretion. Fenretinide glucuronide holds potential for research in the field of cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Fenretinide glucuronide-d4 | Fenretinide glucuronide-d4 is the deuterium labeled Fenretinide glucuronide. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||