81525-13-5
Chemical Structure
Forsythoside B
- CAS No.: 81525-13-5
- Formula:C34H44O19
- Molecular Weight:756.70
IUPAC Name: (2R,3R,4R,5R,6R)-2-((((2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)tetrahydrofuran-2-yl)oxy)methyl)-6-(3,4-dihydroxyphenethoxy)-5-hydroxy-4-(((2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)tetrahydro-2H-pyran-3-yl (E)-3-(3,4-dihydroxy
InChIKey: JMBINOWGIHWPJI-UNSOMVRXSA-N
SMILES: OC1=C(O)C=C(/C=C/C(O[C@H]2[C@H](O[C@]3([H])O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)[C@@H](O)[C@H](OCCC4=CC=C(O)C(O)=C4)O[C@@H]2CO[C@H]5[C@H](O)[C@](CO)(O)CO5)=O)C=C1
Biological Activity: Forsythoside B is a phenylethanoid glycoside isolated from Forsythia suspensa (Thunb.) Vahl, a Chinese folk medicinal plant for treating inflammatory diseases and promoting blood circulation. Forsythoside B could inhibit TNF-alpha, IL-6, IκB and modulate NF-κB.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Forsythoside B | 99.90% | Forsythoside B is a phenylethanoid glycoside isolated from Forsythia suspensa (Thunb.) Vahl, a Chinese folk medicinal plant for treating inflammatory diseases and promoting blood circulation. Forsythoside B could inhibit TNF-alpha, IL-6, IκB and modulate NF-κB. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Forsythoside B (Standard) | ≥98% | Forsythoside B (Standard) is the analytical standard of Forsythoside B. This product is intended for research and analytical applications. Forsythoside B is a phenylethanoid glycoside isolated from Forsythia suspensa (Thunb.) Vahl, a Chinese folk medicinal plant for treating inflammatory diseases and promoting blood circulation. Forsythoside B could inhibit TNF-alpha, IL-6, IκB and modulate NF-κB. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
