81907-61-1
Chemical Structure
Ganoderic acid B
- CAS No.: 81907-61-1
- Formula:C30H44O7
- Molecular Weight:516.67
IUPAC Name: (2R,6R)-6-((3S,5R,7S,10S,13R,14R,17R)-3,7-dihydroxy-4,4,10,13,14-pentamethyl-11,15-dioxo-2,3,4,5,6,7,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methyl-4-oxoheptanoic acid
InChIKey: LWPLEHFGBRFRKI-NBCWKOIPSA-N
SMILES: C[C@]([C@@]([C@]([C@H](C)CC(C[C@@H](C)C(O)=O)=O)([H])C1)(CC2=O)C)(C1=O)C([C@H](C[C@@]3([H])C4(C)C)O)=C2[C@]3(CC[C@@H]4O)C
Biological Activity: Ganoderic acid B is a triterpene isolated from a mushroom Ganoderma lucidum. Ganoderic acid B inhibits the activation of Epstein-Barr virus (EBV) antigens as telomerase inhibitor. Ganoderic acid B is a moderately active inhibitor against HIV-1 protease (IC50: 170 μM)[1][2][3].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ganoderic acid B | 99.60% | Ganoderic acid B is a triterpene isolated from a mushroom Ganoderma lucidum. Ganoderic acid B inhibits the activation of Epstein-Barr virus (EBV) antigens as telomerase inhibitor. Ganoderic acid B is a moderately active inhibitor against HIV-1 protease (IC50: 170 μM). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Ganoderic acid B (Standard) | ≥98% | Ganoderic acid B (Standard) is the analytical standard of Ganoderic acid B. This product is intended for research and analytical applications. Ganoderic acid B is a triterpene isolated from a mushroom Ganoderma lucidum. Ganoderic acid B inhibits the activation of Epstein-Barr virus (EBV) antigens as telomerase inhibitor. Ganoderic acid B is a moderately active inhibitor against HIV-1 protease (IC50: 170 μM). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Zhou S, et al. Triterpenes and Soluble Polysaccharide Changes in Lingzhi or Reishi Medicinal Mushroom, Ganoderma lucidum (Agaricomycetes), During Fruiting Growth. Int J Med Mushrooms. 2018;20(9):859-871. [Content Brief]
- [2]. Zheng DS, et al. Triterpenoids from Ganoderma lucidum inhibit the activation of EBV antigens as telomerase inhibitors. Exp Ther Med. 2017 Oct;14(4):3273-3278. [Content Brief]
- [3]. el-Mekkawy S, et al. Anti-HIV-1 and anti-HIV-1-protease substances from Ganoderma lucidum. Phytochemistry. 1998 Nov;49(6):1651-7. [Content Brief]