82092-80-6
Chemical Structure
Rotenone-d3
- CAS No.: 82092-80-6
- Formula:C23H19D3O6
- Molecular Weight:397.44
IUPAC Name: (2R,6aS,12aS)-9-methoxy-8-(methoxy-d3)-2-(prop-1-en-2-yl)-1,2,12,12a-tetrahydrochromeno[3,4-b]furo[2,3-h]chromen-6(6aH)-one
InChIKey: JUVIOZPCNVVQFO-MKNOOFNASA-N
SMILES: O=C1[C@]2([H])[C@](COC3=CC(OC)=C(OC([2H])([2H])[2H])C=C32)([H])OC4=C5C(O[C@@H](C(C)=C)C5)=CC=C14
Biological Activity: Rotenone-d3 is the deuterium labeled Rotenone (HY-B1756). Rotenone is a mitochondrial electron transport chain complex I inhibitor. Rotenone induces apoptosis through enhancing mitochondrial reactive oxygen species production.
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Rotenone-d3 | Rotenone-d3 is the deuterium labeled Rotenone (HY-B1756). Rotenone is a mitochondrial electron transport chain complex I inhibitor. Rotenone induces apoptosis through enhancing mitochondrial reactive oxygen species production. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Rotenone (Standard) | 99.83% | Rotenone (Standard) is the analytical standard of Rotenone. This product is intended for research and analytical applications. Rotenone is a mitochondrial electron transport chain complex I inhibitor. Rotenone induces apoptosis through enhancing mitochondrial reactive oxygen species production. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Rotenone | 99.80% | Rotenone is a mitochondrial electron transport chain complex I inhibitor. Rotenone induces apoptosis through enhancing mitochondrial reactive oxygen species production. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||