822-18-4
Chemical Structure
α-Linolenic acid sodium
Synonym(s): ALA; C18:3 (9Z,12Z,15Z); C18:3 n-3
- CAS No.: 822-18-4
- Formula:C18H29NaO2
- Molecular Weight:300.41
IUPAC Name: sodium (9Z,12Z,15Z)-octadeca-9,12,15-trienoate
InChIKey: UNZSHUCNBUBSGW-IFNWOZJISA-M
SMILES: CC/C=C\C/C=C\C/C=C\CCCCCCCC(O[Na])=O
Biological Activity: α-Linolenic acid sodium (ALA; C18:3 (9Z,12Z,15Z); C18:3 n-3) is an essential fatty acid that cannot be synthesized by humans. α-Linolenic acid sodium can affect the process of thrombotic through the modulation of PI3K/Akt signaling. α-Linolenic acid sodium possess the anti-arrhythmic properties and is related to cardiovascular disease and cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
α-Linolenic acid sodium | 96.66% | α-Linolenic acid sodium (ALA; C18:3 (9Z,12Z,15Z); C18:3 n-3) is an essential fatty acid that cannot be synthesized by humans. α-Linolenic acid sodium can affect the process of thrombotic through the modulation of PI3K/Akt signaling. α-Linolenic acid sodium possess the anti-arrhythmic properties and is related to cardiovascular disease and cancer. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||