861145-00-8
Chemical Structure
Blapsin B
- CAS No.: 861145-00-8
- Formula:C15H14O5
- Molecular Weight:274.27
InChIKey: OLEHILHKGHOVLE-UHFFFAOYSA-N
SMILES: OC1=CC=C(C2OCCC3=CC(O)=C(C=C32)O)C=C1O
Biological Activity: Blapsin B is a potent 14-3-3 inhibitor and a naturally occurring compound from Blaps japanensis. Blapsin B potently inhibits 14-3-3 protein-protein interactions (PPIs) with an IC50 value of 10.0 μM in the ELISA assay and 2.5 μM in the FP assay, respectively. Blapsin B modulates signaling pathways involved in cell proliferation and transformation. Blapsin B can be used for cancer research[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Blapsin B | Blapsin B is a potent 14-3-3 inhibitor and a naturally occurring compound from Blaps japanensis. Blapsin B potently inhibits 14-3-3 protein-protein interactions (PPIs) with an IC50 value of 10.0 μM in the ELISA assay and 2.5 μM in the FP assay, respectively. Blapsin B modulates signaling pathways involved in cell proliferation and transformation. Blapsin B can be used for cancer research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||