876145-69-6
Chemical Structure
KRP-105
- CAS No.: 876145-69-6
- Formula:C23H22ClN3O3S
- Molecular Weight:455.96
IUPAC Name: (S)-3-(3-(2-(4-chlorophenyl)-4-methylthiazole-5-carboxamido)piperidin-1-yl)benzoic acid
InChIKey: UEIFAMIUBPSKHA-SFHVURJKSA-N
SMILES: OC(C1=CC=CC(N(CCC2)C[C@H]2NC(C3=C(C)N=C(C4=CC=C(C=C4)Cl)S3)=O)=C1)=O
Biological Activity: KRP-105 is a potent, highly selective, and orally effective PPAR alpha (EC50 = 8 nM) agonist. KRP-105 can significantly reduce serum triglyceride, total cholesterol, and non high density lipoprotein cholesterol levels. KRP-105 can be used for research on metabolic diseases such as dyslipidemia[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
KRP-105 | KRP-105 is a potent, highly selective, and orally effective PPAR alpha (EC50 = 8 nM) agonist. KRP-105 can significantly reduce serum triglyceride, total cholesterol, and non high density lipoprotein cholesterol levels. KRP-105 can be used for research on metabolic diseases such as dyslipidemia. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||