88430-50-6
Chemical Structure
(Rac)-Beraprost
Synonym(s): (Rac)-TRK-100 free acid; (Rac)-ML 1229
- CAS No.: 88430-50-6
- Formula:C24H30O5
- Molecular Weight:398.49
InChIKey: CTPOHARTNNSRSR-OUKQBFOZSA-N
SMILES: O=C(CCCC1=CC=CC2=C1OC3CC(C(C23)/C=C/C(C(CC#CC)C)O)O)O
Biological Activity: (Rac)-Beraprost ((Rac)-ML 1229) is an orally active prostacyclin analog that inhibits the release of Ca2+ from intracellular storage sites by binding to prostacyclin membrane receptors (Prostaglandin Receptor), leading to relaxation of smooth muscle cells and vasodilation. Beraprost has vasodilatory, antiplatelet, and cytoprotective effects, making it promising for research in the field of cardiovascular diseases, such as thromboangiitis obliterans and atherosclerosis[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(Rac)-Beraprost | (Rac)-Beraprost ((Rac)-ML 1229) is an orally active prostacyclin analog that inhibits the release of Ca2+ from intracellular storage sites by binding to prostacyclin membrane receptors (Prostaglandin Receptor), leading to relaxation of smooth muscle cells and vasodilation. Beraprost has vasodilatory, antiplatelet, and cytoprotective effects, making it promising for research in the field of cardiovascular diseases, such as thromboangiitis obliterans and atherosclerosis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||