9050-30-0
Chemical Structure
Heparan Sulfate
- CAS No.: 9050-30-0
- Formula:C12H19NO20S3 (monomer)
- Molecular Weight:593.47 (monomer)
SMILES: O=S(OCC1O[C@@H](OC)[C@H](NS(=O)(O)=O)[C@@H](OS(=O)(O)=O)[C@H]1O[C@@H]2OC(C(O)=O)[C@H](O[C@@H]3OC(COS(=O)(O)=O)[C@H](O[C@@H]4OC(C(O)=O)[C@H](OC)[C@H](O)[C@H]4OS(=O)(O)=O)[C@H](O)[C@H]3NS(=O)(O)=O)[C@H](O)[C@H]2O)(O)=O.[n]
Biological Activity: Heparan sulfate, a complex and linear polysaccharide, exists as part of glycoproteins named heparan sulfate proteoglycans, which are expressed abundantly on the cell surface and in the extracellular matrix.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Heparan Sulfate | Heparan sulfate, a complex and linear polysaccharide, exists as part of glycoproteins named heparan sulfate proteoglycans, which are expressed abundantly on the cell surface and in the extracellular matrix. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||