957494-34-7
Chemical Structure
Succinyl-β-cycloaltrin
- CAS No.: 957494-34-7
- Formula:C71H100O55
- Molecular Weight:1833.52
InChIKey: DIRLEDPEXJLCIL-JCWBWLHSSA-N
SMILES: O=C(CCC(C)=O)OC[C@@H](O[C@@](O[C@]([C@H]1O)([H])[C@H](O[C@@](O[C@]([C@H]2O)([H])[C@H](O[C@@](O[C@]([C@H]([C@@H]3O)O)([H])[C@H]4COC(CCC(O)=O)=O)([H])[C@H]2O)COC(CCC(O)=O)=O)([H])[C@H]1O)COC(CCC(O)=O)=O)([H])[C@H]5O)[C@@]([C@H]5O)([H])O[C@@]([C@H]([C@@H]6O)O)([H])O[C@@H]([C@@]6([H])O[C@@]([C@H]([C@@H]7O)O)([H])O[C@@H]([C@@]7([H])O[C@@]([C@H]([C@@H]8O)O)([H])O[C@@H]([C@@]8([H])O[C@@]3([H])O4)COC(CCC(O)=O)=O)COC(CCC(O)=O)=O)COC(CCC(O)=O)=O
Biological Activity: Succinyl-β-cycloaltrin is a modified cyclodextrin with unique chemical properties that make it an effective solubilizer and stabilizer for various compounds, especially in the pharmaceutical industry. Succinyl-β-cycloaltrin has a hydrophobic interior and a hydrophilic exterior, enabling it to form stable clathrates with hydrophobic molecules such as drugs and nutrients. This increases their solubility and bioavailability, making them more effective for recreational or nutritional purposes.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Succinyl-β-cycloaltrin | Succinyl-β-cycloaltrin is a modified cyclodextrin with unique chemical properties that make it an effective solubilizer and stabilizer for various compounds, especially in the pharmaceutical industry. Succinyl-β-cycloaltrin has a hydrophobic interior and a hydrophilic exterior, enabling it to form stable clathrates with hydrophobic molecules such as drugs and nutrients. This increases their solubility and bioavailability, making them more effective for recreational or nutritional purposes. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||