1398065-87-6
Chemical Structure
Forchlorfenuron-d5
- CAS. Nr.: 1398065-87-6
- Formula:C12H5D5ClN3O
- Molecular Weight:252.71
IUPAC Name: 1-(2-chloropyridin-4-yl)-3-(phenyl-d5)urea
InChIKey: GPXLRLUVLMHHIK-RALIUCGRSA-N
SMILES: [2H]C1=C([2H])C([2H])=C([2H])C([2H])=C1NC(NC2=CC=NC(Cl)=C2)=O
Biological Activity: Forchlorfenuron-d5 is the deuterium labeled Forchlorfenuron. Forchlorfenuron is plant growth regulator and cytokinin; can be used to increase fruit size of fruits, such as kiwi fruit and grapes.
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Forchlorfenuron-d5 | Forchlorfenuron-d5 is the deuterium labeled Forchlorfenuron. Forchlorfenuron is plant growth regulator and cytokinin; can be used to increase fruit size of fruits, such as kiwi fruit and grapes. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Forchlorfenuron (Standard) | ≥98% | Forchlorfenuron (Standard) is the analytical standard of Forchlorfenuron. This product is intended for research and analytical applications. Forchlorfenuron is plant growth regulator and cytokinin; can be used to increase fruit size of fruits, such as kiwi fruit and grapes. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Forchlorfenuron | 99.45% | Forchlorfenuron is plant growth regulator and cytokinin; can be used to increase fruit size of fruits, such as kiwi fruit and grapes. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||