121058-88-6
Chemical Structure
Ac-rC Phosphoramidite
- CAS No.: 121058-88-6
- Formula:C47H64N5O9PSi
- Molecular Weight:902.10
IUPAC Name: (2R,3R,4R,5R)-5-(4-acetamido-2-oxopyrimidin-1(2H)-yl)-2-((bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-((tert-butyldimethylsilyl)oxy)tetrahydrofuran-3-yl (2-cyanoethyl) diisopropylphosphoramidite
InChIKey: QKWKXYVKGFKODW-YOEDQOPESA-N
SMILES: COC(C=C1)=CC=C1C(C2=CC=CC=C2)(C3=CC=C(OC)C=C3)OC[C@@H]4[C@@H](OP(N(C(C)C)C(C)C)OCCC#N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N5C(N=C(NC(C)=O)C=C5)=O)O4
Biological Activity: Ac-rC Phosphoramidite is a cytosine phosphoramidite used in the chemical synthesis of RNA oligonucleotides. Ac-rC Phosphoramidite enables the incorporation of cytidine nucleotides into synthetic RNA strands, and its unique protecting groups ensure the structural integrity of the molecule throughout complex synthetic processes[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ac-rC Phosphoramidite | 98.87% | Ac-rC Phosphoramidite is a cytosine phosphoramidite used in the chemical synthesis of RNA oligonucleotides. Ac-rC Phosphoramidite enables the incorporation of cytidine nucleotides into synthetic RNA strands, and its unique protecting groups ensure the structural integrity of the molecule throughout complex synthetic processes. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Ac-rC Phosphoramidite-15N2 | Ac-rC Phosphoramidite-15N2 is 15N labeled Ac-rC Phosphoramidite (HY-W042357). Ac-rC Phosphoramidite is used for the oligoribonucleotide phosphorodithioate modification (PS2-RNA). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
