1334532-23-8
Chemical Structure
Isovalerylcarnitine-d9 chloride
- CAS. Nr.: 1334532-23-8
- Formula:C12H15D9ClNO4
- Molecular Weight:290.83
IUPAC Name: tert-butyl (R)-3-(piperidin-3-yl)azetidine-1-carboxylate
InChIKey: HWDFIOSIRGUUSM-UGYZPRMBSA-N
SMILES: CC(C)CC(O[C@H](CC(O)=O)C[N+](C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])=O.[Cl-]
Biological Activity: Isovalerylcarnitine-d9 chloride is the deuterium labeled Isovalerylcarnitine chloride (HY-145542). Isovalerylcarnitine chloride is a metabolite of leucine. Isovalerylcarnitine chloride can specifically activate calpain in human neutrophils. Isovalerylcarnitine chloride inhibits tumor cell proliferation and induces apoptosis. Elevated circulating levels of Isovalerylcarnitine chloride are negatively correlated with reduced lung cancer risk[1][2].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Isovalerylcarnitine-d9 chloride | Isovalerylcarnitine-d9 chloride is the deuterium labeled Isovalerylcarnitine chloride (HY-145542). Isovalerylcarnitine chloride is a metabolite of leucine. Isovalerylcarnitine chloride can specifically activate calpain in human neutrophils. Isovalerylcarnitine chloride inhibits tumor cell proliferation and induces apoptosis. Elevated circulating levels of Isovalerylcarnitine chloride are negatively correlated with reduced lung cancer risk. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Isovalerylcarnitine chloride (Standard) | ≥98% | Isovalerylcarnitine chloride (Standard) is the analytical standard of Isovalerylcarnitine chloride (HY-145542). This product is intended for research and analytical applications. Isovalerylcarnitine chloride is a metabolite of leucine. Isovalerylcarnitine can specifically activate calpain in human neutrophils. Isovalerylcarnitine chloride inhibits tumor cell proliferation and induces apoptosis. Elevated circulating levels of Isovalerylcarnitine chloride are negatively correlated with reduced lung cancer risk. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Isovalerylcarnitine-d9-1 chloride | 99.55% | Isovalerylcarnitine-d9-1 (chloride) is deuterium labeled Isovalerylcarnitine (chloride). Isovalerylcarnitine chloride, a product of the catabolism of L-leucine, is a potent activator of the Ca2+-dependent proteinase (calpain) of human neutrophils. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Isovalerylcarnitine chloride | 99.48% | Isovalerylcarnitine chloride is a metabolite of leucine. Isovalerylcarnitine chloride can specifically activate calpain in human neutrophils. Isovalerylcarnitine chloride inhibits tumor cell proliferation and induces apoptosis. Elevated circulating levels of Isovalerylcarnitine chloride are negatively correlated with reduced lung cancer risk. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
- [1]. Smith-Byrne K, et al. Circulating Isovalerylcarnitine and Lung Cancer Risk: Evidence from Mendelian Randomization and Prediagnostic Blood Measurements. Cancer Epidemiol Biomarkers Prev. 2022;31(10):1966-1974. [Content Brief]
- [2]. Pontremoli S, et al. Isovalerylcarnitine is a specific activator of calpain of human neutrophils. Biochem Biophys Res Commun. 1987 Nov 13;148(3):1189-95. [Content Brief]