1356933-89-5
Chemical Structure
Ergothioneine-d3
Synonym(s): L-(+)-Ergothioneine-d3
- CAS No.: 1356933-89-5
- Formula:C9H12D3N3O2S
- Molecular Weight:232.32
IUPAC Name: (S)-2-(dimethyl(methyl-d3)ammonio)-3-(2-thioxo-2,3-dihydro-1H-imidazol-4-yl)propanoate
InChIKey: SSISHJJTAXXQAX-LNEZGBMJSA-N
SMILES: S=C1NC(C[C@@H](C([O-])=O)[N+](C)(C([2H])([2H])[2H])C)=CN1
Biological Activity: Ergothioneine-d3 is the deuterium labeled Ergothioneine. Ergothioneine, an imidazole-2-thione derivative of histidine betaine, is synthesized by certain bacteria and fungi. Ergothioneine is generally considered an antioxidant[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ergothioneine-d3 | Ergothioneine-d3 is the deuterium labeled Ergothioneine. Ergothioneine, an imidazole-2-thione derivative of histidine betaine, is synthesized by certain bacteria and fungi. Ergothioneine is generally considered an antioxidant. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Ergothioneine (Standard) | 99.97% | Delphinidin-3-O-galactoside (chloride) (Standard) is the analytical standard of Delphinidin-3-O-galactoside (chloride). This product is intended for research and analytical applications. Delphinidin-3-O-galactoside (chloride) is an anthocyanin that extracts from wheat flour. Delphinidin-3-O-galactoside (chloride) can be used for the research of antioxidant and antimicrobial. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Ergothioneine-d9 | 99.80% | Ergothioneine-d9 is the deuterium labeled Ergothioneine. Ergothioneine, an imidazole-2-thione derivative of histidine betaine, is synthesized by certain bacteria and fungi. Ergothioneine is generally considered an antioxidant. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Ergothioneine | 99.98% | Ergothioneine is an imidazole-2-thione derivative with orally active histidine betaine. Ergothioneine is a specific inhibitor of p38-MAPK and Akt, which plays a protective role in cell apoptosis induced by stress. Ergothioneine has antioxidant activity. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||