1421611-59-7
Chemical Structure
Ganorbiformin B
- CAS No.: 1421611-59-7
- Formula:C34H50O7
- Molecular Weight:570.76
IUPAC Name: (5S,6S,E)-5-acetoxy-6-((3S,5R,10S,13R,14R,17R)-3-acetoxy-4,4,10,13,14-pentamethyl-7-oxo-2,3,4,5,6,7,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enoic acid
InChIKey: FPSBBGUSAFEFFR-ITEMVNEESA-N
SMILES: C[C@]12C3=C(CC[C@@]1([C@@](CC2)([H])[C@H](C)[C@@H](OC(C)=O)C/C=C(C)/C(O)=O)C)[C@@]4([C@@](C(C)([C@H](CC4)OC(C)=O)C)([H])CC3=O)C
Biological Activity: Ganorbiformin B is a lanostane triterpenoid. Ganorbiformin B shares the same lanostane skeleton with known ganoderic acids. The C-3 epimer of ganoderic acid T exhibits potent antimycobacterial activity against Mycobacterium tuberculosis H37Ra[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Ganorbiformin B | Ganorbiformin B is a lanostane triterpenoid. Ganorbiformin B shares the same lanostane skeleton with known ganoderic acids. The C-3 epimer of ganoderic acid T exhibits potent antimycobacterial activity against Mycobacterium tuberculosis H37Ra. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||