1449382-91-5
Chemical Structure
Chlojaponilactone B
- CAS No.: 1449382-91-5
- Formula:C17H18O4
- Molecular Weight:286.32
IUPAC Name: (4R,4aS,5aS,6aR,6bS)-3,6b-dimethyl-5-methylene-2-oxo-2,4,4a,5,5a,6,6a,6b-octahydrocyclopropa[2,3]indeno[5,6-b]furan-4-yl acetate
InChIKey: DJENQWQXZQCLHL-PVBKFEAWSA-N
SMILES: C[C@]12[C@@](C([C@]3([H])[C@@]2([H])C3)=C)([H])[C@H](C(C(O4)=C1)=C(C)C4=O)OC(C)=O
Biological Activity: Chlojaponilactone B is a lindenane-type sesquiterpenoid with anti-inflammatory properties. Chlojaponilactone B suppresses inflammatory responses by inhibiting TLR4 and subsequently decreasing reactive oxygen species (ROS) generation, downregulating the NF-κB, thus reducing the expression of the pro-inflammatory cytokines iNOS, NO, COX-2, IL-6 and TNF-α[1].
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Chlojaponilactone B | 98.0% | Chlojaponilactone B is a lindenane-type sesquiterpenoid with anti-inflammatory properties. Chlojaponilactone B suppresses inflammatory responses by inhibiting TLR4 and subsequently decreasing reactive oxygen species (ROS) generation, downregulating the NF-κB, thus reducing the expression of the pro-inflammatory cytokines iNOS, NO, COX-2, IL-6 and TNF-α. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||