1825377-28-3
Chemical Structure
Danofloxacin-d3
- CAS No.: 1825377-28-3
- Formula:C19H17D3FN3O3
- Molecular Weight:360.40
IUPAC Name: 1-cyclopropyl-6-fluoro-7-((1S,4S)-5-(methyl-d3)-2,5-diazabicyclo[2.2.1]heptan-2-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid
InChIKey: QMLVECGLEOSESV-DEPZVSDUSA-N
SMILES: O=C(C1=CN(C2CC2)C3=C(C=C(F)C(N4[C@](C5)([H])CN(C([2H])([2H])[2H])[C@]5([H])C4)=C3)C1=O)O
Biological Activity: Danofloxacin-d3 is deuterium labeled Danofloxacin. Danofloxacin is an orally active quinolone antibiotic. Danofloxacin targets bacterial DNA gyrase and inhibits bacterial DNA replication, transcription and growth. Danofloxacin can be used for various bacterial infections caused by Escherichia coli, Mycoplasma and other pathogens.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Danofloxacin-d3 | Danofloxacin-d3 is deuterium labeled Danofloxacin. Danofloxacin is an orally active quinolone antibiotic. Danofloxacin targets bacterial DNA gyrase and inhibits bacterial DNA replication, transcription and growth. Danofloxacin can be used for various bacterial infections caused by Escherichia coli, Mycoplasma and other pathogens. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Danofloxacin (Standard) | ≥98% | Danofloxacin (Standard) is the analytical standard of Danofloxacin. This product is intended for research and analytical applications. Danofloxacin is an orally active quinolone antibiotic. Danofloxacin targets bacterial DNA gyrase and inhibits bacterial DNA replication, transcription and growth. Danofloxacin can be used for various bacterial infections caused by Escherichia coli, Mycoplasma and other pathogens. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Danofloxacin-d3-1 | 99.85% | Danofloxacin-d3-1 is deuterium labeled Danofloxacin. Danofloxacin is an orally active quinolone antibiotic. Danofloxacin targets bacterial DNA gyrase and inhibits bacterial DNA replication, transcription and growth. Danofloxacin can be used for various bacterial infections caused by Escherichia coli, Mycoplasma and other pathogens. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Danofloxacin | 98.56% | Danofloxacin is an orally active quinolone antibiotic. Danofloxacin targets bacterial DNA gyrase and inhibits bacterial DNA replication, transcription and growth. Danofloxacin can be used for various bacterial infections caused by Escherichia coli, Mycoplasma and other pathogens. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
