195533-98-3
Chemical Structure
Batabulin sodium
Synonym(s): T138067 sodium
- CAS No.: 195533-98-3
- Formula:C13H6F6NNaO3S
- Molecular Weight:393.24
IUPAC Name: sodium (3-fluoro-4-methoxyphenyl)((perfluorophenyl)sulfonyl)amide
InChIKey: UWPXRVDIKGZQQW-UHFFFAOYSA-N
SMILES: O=S(C1=C(F)C(F)=C(F)C(F)=C1F)([N-]C2=CC=C(OC)C(F)=C2)=O.[Na+]
Biological Activity: Batabulin sodium (T138067 sodium) is an antitumor agent, which binds covalently and selectively to a subset of the β-tubulin isotypes, thereby disrupting microtubule polymerization. Batabulin sodium affects cell morphology and leads to cell-cycle arrest ultimately induces apoptotic cell death[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Batabulin sodium | 99.76% | Batabulin sodium (T138067 sodium) is an antitumor agent, which binds covalently and selectively to a subset of the β-tubulin isotypes, thereby disrupting microtubule polymerization. Batabulin sodium affects cell morphology and leads to cell-cycle arrest ultimately induces apoptotic cell death. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
