2095616-82-1
Chemical Structure
CH7057288
- CAS No.: 2095616-82-1
- Formula:C32H31N3O5S
- Molecular Weight:569.67
IUPAC Name: N-(tert-butyl)-2-((6,6-dimethyl-8-(methylsulfonamido)-11-oxo-6,11-dihydronaphtho[2,3-b]benzofuran-3-yl)ethynyl)-6-methylisonicotinamide
InChIKey: DCGOHGQJHJXBGW-UHFFFAOYSA-N
SMILES: O=C1C2=C(OC3=CC(C#CC4=CC(C(NC(C)(C)C)=O)=CC(C)=N4)=CC=C23)C(C)(C)C5=CC(NS(C)(=O)=O)=CC=C15
Biological Activity: CH7057288 is a potent and selective TRK inhibitor. CH7057288 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
CH7057288 | 99.73% | CH7057288 is a potent and selective TRK inhibitor. CH7057288 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
CH7057288 (Standard) | CH7057288 (Standard) is the analytical standard of CH7057288 (HY-107362). This product is intended for research and analytical applications. CH7057288 is a potent and selective TRK inhibitor. CH7057288 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||