2102591-12-6
Chemical Structure
6'Nicotinate Ac4ManNAz
- CAS No.: 2102591-12-6
- Formula:C20H23N5O10
- Molecular Weight:493.42
InChIKey: JBNODVOTKMIJRC-DRWJQLDWSA-N
SMILES: O=C(O[C@H]1[C@H](OC(C)=O)[C@H](NC(CN=[N+]=[N-])=O)[C@@H](OC(C2=CN=CC=C2)=O)O[C@@H]1COC(C)=O)C
Biological Activity: 6'Nicotinate Ac4ManNAz (Compound 2) is a brain-penetrant carbohydrate-neuroactive heteromer conjugating Ac4ManNAz (HY-W728531) and Nicotinic acid (HY-B0143). 6'Nicotinate Ac4ManNAz can be used for the development of glycosylation-regulating agents or diagnostic probes that cross the BBB[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
6'Nicotinate Ac4ManNAz | 6'Nicotinate Ac4ManNAz (Compound 2) is a brain-penetrant carbohydrate-neuroactive heteromer conjugating Ac4ManNAz (HY-W728531) and Nicotinic acid (HY-B0143). 6'Nicotinate Ac4ManNAz can be used for the development of glycosylation-regulating agents or diagnostic probes that cross the BBB. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||