2110448-98-9
Chemical Structure
Azido-PEG3-O-NHS ester
- CAS No.: 2110448-98-9
- Formula:C13H20N4O8
- Molecular Weight:360.32
IUPAC Name: 2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethyl (2,5-dioxopyrrolidin-1-yl) carbonate
InChIKey: RIGURCMIYKOKGN-UHFFFAOYSA-N
SMILES: O=C(OCCOCCOCCOCCN=[N+]=[N-])ON(C1=O)C(CC1)=O
Biological Activity: Azido-PEG3-O-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG3-O-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG3-O-NHS ester | 95.0% | Azido-PEG3-O-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG3-O-NHS ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
