2319647-97-5
Chemical Structure
ZLN005 hydrochloride
- CAS No.: 2319647-97-5
- Formula:C17H19ClN2
- Molecular Weight:286.80
InChIKey: PRHDHWLJRJJOED-UHFFFAOYSA-N
SMILES: CC(C)(C1=CC=C(C2=NC3=CC=CC=C3N2)C=C1)C.Cl
Biological Activity: ZLN005 (hydrochloride) is a peroxisome proliferator-activated receptor-g coactivator-1a (PGC-1α) activator. ZLN005 (hydrochloride) can stimulate the expression of PGC-1α and downstream genes in skeletal muscle cells, improve glucose utilization and fatty acid oxidation. ZLN005 (hydrochloride) can increase the transcription of PGC-1α and downstream genes in skeletal muscle of diabetic db/db mice, increase fat oxidation and improve glucose tolerance, pyruvate tolerance and insulin sensitivity[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
ZLN005 hydrochloride | ZLN005 (hydrochloride) is a peroxisome proliferator-activated receptor-g coactivator-1a (PGC-1α) activator. ZLN005 (hydrochloride) can stimulate the expression of PGC-1α and downstream genes in skeletal muscle cells, improve glucose utilization and fatty acid oxidation. ZLN005 (hydrochloride) can increase the transcription of PGC-1α and downstream genes in skeletal muscle of diabetic db/db mice, increase fat oxidation and improve glucose tolerance, pyruvate tolerance and insulin sensitivity. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
