2364589-86-4
Chemical Structure
Suraxavir marboxil
Synonym(s): GP681; Cap-dependent endonuclease-IN-3
- CAS. Nr.: 2364589-86-4
- Formula:C29H25F2N3O7S
- Molecular Weight:597.59
IUPAC Name: (E)-6-((6-chloro-2-methyl-2H-indazol-5-yl)imino)-3-((1-methyl-1H-1,2,4-triazol-3-yl)methyl)-1-(2,4,5-trifluorobenzyl)-1,3,5-triazinane-2,4-dione
InChIKey: IVHSRYSBKJOVJK-VWNXMTODSA-N
SMILES: O=C1N2[C@](COC3(CC3)C2)([H])N([C@@]4([H])C5=CC=C(F)C(F)=C5CSC6=CC=CC=C64)N7C1=C(C(C=C7)=O)OCOC(OC)=O
Biological Activity: Suraxavir marboxil (GP681; Cap-dependent endonuclease-IN-3) is a PA subunit cap-dependent endonuclease inhibitor with antiviral activity. Suraxavir marboxil inhibits PA subunit cap-dependent endonuclease activity and inhibits influenza A and/or influenza B viral replication. Suraxavir marboxil can be used alone or in combination with other anti-influenzal agents for the prevention of influenza A and/or influenza B viral infectious diseases. Suraxavir marboxil can be used for the research of influenza A and/or influenza B viral infectious diseases[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Suraxavir marboxil | Suraxavir marboxil (GP681; Cap-dependent endonuclease-IN-3) is a PA subunit cap-dependent endonuclease inhibitor with antiviral activity. Suraxavir marboxil inhibits PA subunit cap-dependent endonuclease activity and inhibits influenza A and/or influenza B viral replication. Suraxavir marboxil can be used alone or in combination with other anti-influenzal agents for the prevention of influenza A and/or influenza B viral infectious diseases. Suraxavir marboxil can be used for the research of influenza A and/or influenza B viral infectious diseases. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
