2438239-83-7
Chemical Structure
ABT-002
- CAS No.: 2438239-83-7
- Formula:C14H11FN2O5
- Molecular Weight:306.25
IUPAC Name: 2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxoisoindoline-5-carboxylic acid
InChIKey: OBCYSDKGKQWABZ-UHFFFAOYSA-N
SMILES: O=C1CCC(C(N1)=O)N2CC3=C(C2=O)C=C(C(C(O)=O)=C3)F
Biological Activity: ABT-002 is a molecular glue degrader targeting GSPT1 and NEK7. ABT-002 is the active metabolite of ABS-752 (HY-W599279). ABT-002 directly binds the E3 ubiquitin ligase complex component CRBN and the neo-substrates (GSPT1 and NEK7) to form a stable CRBN-substrate ternary complex, thereby inducing ubiquitination and degradation of the target proteins and triggering subsequent cytotoxicity and antitumor effects. ABT-002 can be used for research on hepatocellular carcinoma[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
ABT-002 | ABT-002 is a molecular glue degrader targeting GSPT1 and NEK7. ABT-002 is the active metabolite of ABS-752 (HY-W599279). ABT-002 directly binds the E3 ubiquitin ligase complex component CRBN and the neo-substrates (GSPT1 and NEK7) to form a stable CRBN-substrate ternary complex, thereby inducing ubiquitination and degradation of the target proteins and triggering subsequent cytotoxicity and antitumor effects. ABT-002 can be used for research on hepatocellular carcinoma. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
