26247-79-0
26247-79-0
Chemical Structure
Poly-L-glutamic acid sodium salt (MW 30000)
- CAS No.: 26247-79-0
- Formula:N/A
- Molecular Weight:30000 (Average)
SMILES: CC(C(CCC(O[Na])=O)NC)=O.[n]
Biological Activity: Poly-L-glutamic acid sodium salt (MW 30000) is a synthetic polypeptide with biocompatibility, biodegradability and non-immunogenicity. Poly-L-glutamic acid sodium salt is an ideal tumor-targeting polymer carrier. Poly-L-glutamic acid sodium salt can be hydrolyzed by cathepsin B during metabolic decomposition[1][2][3].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Poly-L-glutamic acid sodium salt (MW 30000) | Poly-L-glutamic acid sodium salt (MW 30000) is a synthetic polypeptide with biocompatibility, biodegradability and non-immunogenicity. Poly-L-glutamic acid sodium salt is an ideal tumor-targeting polymer carrier. Poly-L-glutamic acid sodium salt can be hydrolyzed by cathepsin B during metabolic decomposition. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Poly-L-glutamic acid sodium salt (MW 120000) | Poly-L-glutamic acid sodium salt (MW 120000) is a synthetic polypeptide with biocompatibility, biodegradability and non-immunogenicity. Poly-L-glutamic acid sodium salt is an ideal tumor-targeting polymer carrier. Poly-L-glutamic acid sodium salt can be hydrolyzed by cathepsin B during metabolic decomposition. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Poly-L-glutamic acid sodium salt (MW 60000) | Poly-L-glutamic acid sodium salt (MW 60000) is a synthetic polypeptide with biocompatibility, biodegradability and non-immunogenicity. Poly-L-glutamic acid sodium salt is an ideal tumor-targeting polymer carrier. Poly-L-glutamic acid sodium salt can be hydrolyzed by cathepsin B during metabolic decomposition. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Poly-L-glutamic acid sodium salt (MW 3000) | Poly-L-glutamic acid sodium salt (MW 3000) is a synthetic polypeptide with biocompatibility, biodegradability and non-immunogenicity. Poly-L-glutamic acid sodium salt is an ideal tumor-targeting polymer carrier. Poly-L-glutamic acid sodium salt can be hydrolyzed by cathepsin B during metabolic decomposition. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Poly-L-glutamic acid sodium salt (MW 45000) | Poly-L-glutamic acid sodium salt (MW 45000) is a synthetic polypeptide with biocompatibility, biodegradability and non-immunogenicity. Poly-L-glutamic acid sodium salt is an ideal tumor-targeting polymer carrier. Poly-L-glutamic acid sodium salt can be hydrolyzed by cathepsin B during metabolic decomposition. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Poly-L-glutamic acid sodium salt (MW 15000) | Poly-L-glutamic acid sodium salt (MW 15000) is a synthetic polypeptide with biocompatibility, biodegradability and non-immunogenicity. Poly-L-glutamic acid sodium salt is an ideal tumor-targeting polymer carrier. Poly-L-glutamic acid sodium salt can be hydrolyzed by cathepsin B during metabolic decomposition. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Poly-L-glutamic acid sodium salt (MW 7500) | Poly-L-glutamic acid sodium salt (MW 7500) is a synthetic polypeptide with biocompatibility, biodegradability and non-immunogenicity. Poly-L-glutamic acid sodium salt is an ideal tumor-targeting polymer carrier. Poly-L-glutamic acid sodium salt can be hydrolyzed by cathepsin B during metabolic decomposition. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
- [1]. Singer JW, et al. Poly-(L)-glutamic acid-paclitaxel (CT-2103) [XYOTAX], a biodegradable polymeric drug conjugate: characterization, preclinical pharmacology, and preliminary clinical data. Adv Exp Med Biol. 2003;519:81-99. [Content Brief]
- [2]. Li C. Poly(L-glutamic acid)--anticancer drug conjugates. Adv Drug Deliv Rev. 2002 Sep 13;54(5):695-713. [Content Brief]
- [3]. Hasannia M, et al. Targeted poly(L-glutamic acid)-based hybrid peptosomes co-loaded with doxorubicin and USPIONs as a theranostic platform for metastatic breast cancer. Nanomedicine. 2023 Feb;48:102645. [Content Brief]
Keywords
- Poly-L-glutamic acid sodium salt (MW 30000)
- Poly-L-glutamic acid sodium salt (MW 120000)
- Poly-L-glutamic acid sodium salt (MW 60000)
- Poly-L-glutamic acid sodium salt (MW 3000)
- Poly-L-glutamic acid sodium salt (MW 45000)
- Poly-L-glutamic acid sodium salt (MW 15000)
- Poly-L-glutamic acid sodium salt (MW 7500)
