2669072-88-0
Chemical Structure
PROTAC HSP90 degrader BP3
- CAS No.: 2669072-88-0
- Formula:C32H29ClN8O5
- Molecular Weight:641.08
IUPAC Name: 2-(hydroxymethyl)isonicotinamide
InChIKey: ZSERQSKFLSKTGE-UHFFFAOYSA-N
SMILES: O=C1N(C(CC2)C(NC2=O)=O)C(C3=C1C=CC=C3NCCC#CC4=CN(CC5=NC=C(C)C(OC)=C5C)C6=NC(N)=NC(Cl)=C64)=O
Biological Activity: PROTAC HSP90 degrader BP3 is a potent and selective degradation of HSP90 in a CRBN-dependent fashion. PROTAC HSP90 degrader BP3 has a certain degradation effect on HSP90 protein in MCF-7 cells (DC50=0.99 μM). PROTAC HSP90 degrader BP3 inhibits the growth of breast cancer cell[1]. PROTAC HSP90 degrader BP3 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
PROTAC HSP90 degrader BP3 | 99.54% | PROTAC HSP90 degrader BP3 is a potent and selective degradation of HSP90 in a CRBN-dependent fashion. PROTAC HSP90 degrader BP3 has a certain degradation effect on HSP90 protein in MCF-7 cells (DC50=0.99 μM). PROTAC HSP90 degrader BP3 inhibits the growth of breast cancer cell. PROTAC HSP90 degrader BP3 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords