2748150-20-9
Chemical Structure
Lenalidomide-propargyl-C2-amido-Ph-NH2 hydrochloride
- CAS No.: 2748150-20-9
- Formula:C25H25ClN4O4
- Molecular Weight:480.94
IUPAC Name: 4-amino-N-(5-(2-(2,6-dioxopiperidin-3-yl)-1-oxoisoindolin-4-yl)pent-4-yn-1-yl)benzamide hydrochloride
InChIKey: CUMXORBICFYTPG-UHFFFAOYSA-N
SMILES: O=C1C2=C(CN1C3C(NC(CC3)=O)=O)C(C#CCCCNC(C4=CC=C(C=C4)N)=O)=CC=C2.[H]Cl
Biological Activity: Lenalidomide-propargyl-C2-amido-Ph-NH2 hydrochloride incorporates a cereblon (CRBN) ligand for the E3 ubiquitin ligase and a linker. Lenalidomide-propargyl-C2-amido-Ph-NH2 hydrochloride can be used to design the PROTAC MD-224 (HY-114312)[1]. Lenalidomide-propargyl-C2-amido-Ph-NH2 (hydrochloride) is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Lenalidomide-propargyl-C2-amido-Ph-NH2 hydrochloride | Lenalidomide-propargyl-C2-amido-Ph-NH2 hydrochloride incorporates a cereblon (CRBN) ligand for the E3 ubiquitin ligase and a linker. Lenalidomide-propargyl-C2-amido-Ph-NH2 hydrochloride can be used to design the PROTAC MD-224 (HY-114312). Lenalidomide-propargyl-C2-amido-Ph-NH2 (hydrochloride) is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
