2839159-12-3
Chemical Structure
Antiallergic agent-1
- CAS. Nr.: 2839159-12-3
- Formula:C27H19F6N5O
- Molecular Weight:543.46
IUPAC Name: 3-((2-amino-5-(1-methyl-1H-pyrazol-4-yl)pyridin-3-yl)ethynyl)-N-(3,5-bis(trifluoromethyl)phenyl)-4-methylbenzamide
InChIKey: CEUSZLVORFRBCV-UHFFFAOYSA-N
SMILES: CN1N=CC(C2=CN=C(C(C#CC3=CC(C(NC4=CC(C(F)(F)F)=CC(C(F)(F)F)=C4)=O)=CC=C3C)=C2)N)=C1
Biological Activity: Antiallergic agent-1, a Src-family kinase inhibitor, may serve as a new valuable lead compound for future antiallergic agent discovery. Antiallergic agent-1 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Antiallergic agent-1 | Antiallergic agent-1, a Src-family kinase inhibitor, may serve as a new valuable lead compound for future antiallergic agent discovery. Antiallergic agent-1 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||