2965296-86-8
Chemical Structure
Tetrabutylammonium-d36 bromide
Synonym(s): AP 6G-d36 bromide; Actiron 43-65-d36 bromide; Aliquat 100-d36 bromide
- CAS No.: 2965296-86-8
- Formula:C16D36BrN
- Molecular Weight:358.59
InChIKey: JRMUNVKIHCOMHV-ZTCNRNIXSA-M
SMILES: [2H]C([2H])(C([2H])(C([2H])([N+](C([2H])(C([2H])(C([2H])(C([2H])([2H])[2H])[2H])[2H])[2H])(C([2H])(C([2H])(C([2H])([2H])C([2H])([2H])[2H])[2H])[2H])C([2H])(C([2H])(C([2H])(C([2H])([2H])[2H])[2H])[2H])[2H])[2H])[2H])C([2H])([2H])[2H].[Br-]
Biological Activity: Tetrabutylammonium-d36 bromide (AP 6G-d36 bromide) is the deuterium labeled Tetrabutylammonium bromide (HY-D0172). Tetrabutylammonium bromide is an organic ammonium compound, which is often used in catalytic reactions and separation and purification processes. It has a significant catalytic effect in some organic synthesis reactions, and can be used as a surfactant, stabilizer and antibacterial agent, etc. In addition, in some laboratory studies, this compound has also been used as an ion exchanger, solvent extractant, etc.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Tetrabutylammonium-d36 bromide | Tetrabutylammonium-d36 bromide (AP 6G-d36 bromide) is the deuterium labeled Tetrabutylammonium bromide (HY-D0172). Tetrabutylammonium bromide is an organic ammonium compound, which is often used in catalytic reactions and separation and purification processes. It has a significant catalytic effect in some organic synthesis reactions, and can be used as a surfactant, stabilizer and antibacterial agent, etc. In addition, in some laboratory studies, this compound has also been used as an ion exchanger, solvent extractant, etc. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Tetrabutylammonium bromide | 98.0% | Tetrabutylammonium bromide is an organic ammonium compound, which is often used in catalytic reactions and separation and purification processes. It has a significant catalytic effect in some organic synthesis reactions, and can be used as a surfactant, stabilizer and antibacterial agent, etc. In addition, in some laboratory studies, this compound has also been used as an ion exchanger, solvent extractant, etc. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
