3035433-94-1
Chemical Structure
Pt(II)-NHC complex 2C
Synonym(s): Platinum(II)-N-heterocyclic carbene complex 2C
- CAS No.: 3035433-94-1
- Formula:C24H23F2I2N3Pt
- Molecular Weight:840.35
InChIKey: ITEFIUGVUZTPOM-UHFFFAOYSA-L
SMILES: I[Pt](I)([N]1=CC=CC=C1)=C(N2CC)N(CC)C(C3=CC=C(F)C=C3)=C2C4=CC=C(F)C=C4
Biological Activity: Pt(II)-NHC Complex 2C (Platinum(II)-N-Heterocyclic Carbene complex 2C) (Compound 2C) is a platinum(II) complex based on N-heterocyclic carbene (NHC). Pt(II)-NHC Complex 2C is an immunogenic cell death (ICD) inducer that can induce endoplasmic reticulum stress (ERS) in liver cancer cells and produce reactive oxygen species (ROS), ultimately leading to the release of damage-associated molecular patterns (DAMP). Pt(II)-NHC Complex 2C blocks the cell cycle at the S phase and significantly induces cell apoptosis. Pt(II)-NHC Complex 2C shows anti-liver cancer potential in mouse models and activates immune cells in liver injury models.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Pt(II)-NHC complex 2C | Pt(II)-NHC Complex 2C (Platinum(II)-N-Heterocyclic Carbene complex 2C) (Compound 2C) is a platinum(II) complex based on N-heterocyclic carbene (NHC). Pt(II)-NHC Complex 2C is an immunogenic cell death (ICD) inducer that can induce endoplasmic reticulum stress (ERS) in liver cancer cells and produce reactive oxygen species (ROS), ultimately leading to the release of damage-associated molecular patterns (DAMP). Pt(II)-NHC Complex 2C blocks the cell cycle at the S phase and significantly induces cell apoptosis. Pt(II)-NHC Complex 2C shows anti-liver cancer potential in mouse models and activates immune cells in liver injury models. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
