3101670-33-8
Chemical Structure
DMG-PEG2000-Mal
- CAS. Nr.: 3101670-33-8
- Formula:(C2H4O)nC40H70N2O8
- Molecular Weight:2000 (Average)
SMILES: CCCCCCCCCCCCCC(OC(COCCOCCNC(CCN1C(C=CC1=O)=O)=O)COC(CCCCCCCCCCCCC)=O)=O.[n]
Biological Activity: DMG-PEG2000-Mal is a pegylated lipid with a molecular weight of 2000. DMG-PEG-Mal serves as a component of lipid nanoparticles for mRNA delivery[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
DMG-PEG2000-Mal | 99.58% | DMG-PEG2000-Mal is a pegylated lipid with a molecular weight of 2000. DMG-PEG-Mal serves as a component of lipid nanoparticles for mRNA delivery. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
DMG-PEG5000-Mal | DMG-PEG5000-Mal is a PEG derivative composed of N,N-Dimethylglycine (DMG), PEG units and Maleimide (HY-W007324). Maleimide forms a stable thioether bond with sulfhydryl (-SH) groups. DMG-PEG5000-Mal can be used for drug delivery. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
DMG-PEG1000-Mal | DMG-PEG1000-Mal is a PEG derivative composed of N,N-Dimethylglycine (DMG), PEG units and Maleimide (HY-W007324). Maleimide forms a stable thioether bond with sulfhydryl (-SH) groups. DMG-PEG1000-Mal can be used for drug delivery. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
DMG-PEG10000-Mal | DMG-PEG10000-Mal is a PEG derivative composed of N,N-Dimethylglycine (DMG), PEG units and Maleimide (HY-W007324). Maleimide forms a stable thioether bond with sulfhydryl (-SH) groups. DMG-PEG10000-Mal can be used for drug delivery. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
DMG-PEG3400-Mal | DMG-PEG3400-Mal is a PEG derivative composed of N,N-Dimethylglycine (DMG), PEG units and Maleimide (HY-W007324). Maleimide forms a stable thioether bond with sulfhydryl (-SH) groups. DMG-PEG3400-Mal can be used for drug delivery. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||