31966-52-6
Chemical Structure
8-Azido-cAMP
- CAS No.: 31966-52-6
- Formula:C10H11N8O6P
- Molecular Weight:370.22
IUPAC Name: (4aR,6R,7R,7aS)-6-(6-amino-8-azido-9H-purin-9-yl)-2,7-dihydroxytetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinine 2-oxide
InChIKey: KTMLKBFMGWQTEK-UUOKFMHZSA-N
SMILES: [H][C@]([C@]1([H])O2)(OP(OC1)(O)=O)[C@@H](O)[C@]2([H])N3C4=NC=NC(N)=C4N=C3N=[N+]=[N-]
Biological Activity: 8-Azido-cAMP is a fluorescent cAMP analog, acting as the model target of detecting cAMP[1]. 8-Azido-cAMP is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
8-Azido-cAMP | 8-Azido-cAMP is a fluorescent cAMP analog, acting as the model target of detecting cAMP. 8-Azido-cAMP is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
