326495-44-7
326495-44-7
Chemical Structure
16:0-18:1 PE-d31
- CAS No.: 326495-44-7
- Formula:C39H45D31NO8P
- Molecular Weight:749.19
IUPAC Name: sodium (R)-2,3-bis((tetradecanoyl-d27)oxy)propyl (2,3-dihydroxypropyl) phosphate
InChIKey: FHQVHHIBKUMWTI-UAXXPTAZSA-N
SMILES: CCCCCCCC/C=C\CCCCCCCC(O[C@@H](COP(OCCN)(O)=O)COC(C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])=O)=O
Biological Activity: 16:0-18:1 PE-d31 is deuterium labeled 16:0-18:1 PE.
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
16:0-18:1 PE-d31 | 99% | 16:0-18:1 PE-d31 is deuterium labeled 16:0-18:1 PE. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
1-Palmitoyl-2-oleoyl-sn-glycero-3-PE (Standard) | ≥98% | 1-Palmitoyl-2-oleoyl-sn-glycero-3-PE (Standard) (1,2-POPE (Standard)) is the analytical standard of 1-Palmitoyl-2-oleoyl-sn-glycero-3-PE (HY-W583868). This product is intended for research and analytical applications. 1-Palmitoyl-2-oleoyl-sn-glycero-3-PE is a phosphatidylethanolamine (PE) lipid. 1-Palmitoyl-2-oleoyl-sn-glycero-3-PE can induce lipid bilayer to form a hexagonal phase (HII) structure in an acidic environment and promote membrane fusion. 1-Palmitoyl-2-oleoyl-sn-glycero-3-PE can enhance the endosomal escape ability of lipid nanoparticles (LNPs) and improve the cellular delivery efficiency of nucleic acid drugs such as mRNA. 1-Palmitoyl-2-oleoyl-sn-glycero-3-PE can be used for LNP carrier targeting of gene therapy and mRNA vaccines. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
1-Palmitoyl-2-oleoyl-sn-glycero-3-PE-d62 | 1-Palmitoyl-2-oleoyl-sn-glycero-3-PE-d62 (1,2-POPE-d62) is the deuterium labeled 1-Palmitoyl-2-oleoyl-sn-glycero-3-PE. 1-Palmitoyl-2-oleoyl-sn-glycero-3-PE (1,2-POPE; 16:0-18:1 PE) is a phosphatidylethanolamine (PE) lipid. 1-Palmitoyl-2-oleoyl-sn-glycero-3-PE can induce lipid bilayer to form a hexagonal phase (HII) structure in an acidic environment and promote membrane fusion. 1-Palmitoyl-2-oleoyl-sn-glycero-3-PE can enhance the endosomal escape ability of lipid nanoparticles (LNPs) and improve the cellular delivery efficiency of nucleic acid drugs such as mRNA. 1-Palmitoyl-2-oleoyl-sn-glycero-3-PE can be used for LNP carrier targeting of gene therapy and mRNA vaccines. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
1-Palmitoyl-2-oleoyl-sn-glycero-3-PE | 99.20% | 1-Palmitoyl-2-oleoyl-sn-glycero-3-PE (1,2-POPE; 16:0-18:1 PE) is a phosphatidylethanolamine (PE) lipid. 1-Palmitoyl-2-oleoyl-sn-glycero-3-PE can induce lipid bilayer to form a hexagonal phase (HII) structure in an acidic environment and promote membrane fusion. 1-Palmitoyl-2-oleoyl-sn-glycero-3-PE can enhance the endosomal escape ability of lipid nanoparticles (LNPs) and improve the cellular delivery efficiency of nucleic acid drugs such as mRNA. 1-Palmitoyl-2-oleoyl-sn-glycero-3-PE can be used for LNP carrier targeting of gene therapy and mRNA vaccines. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
