34175-96-7
Chemical Structure
Pterosin B
- CAS No.: 34175-96-7
- Formula:C14H18O2
- Molecular Weight:218.30
IUPAC Name: (R)-6-(2-hydroxyethyl)-2,5,7-trimethyl-2,3-dihydro-1H-inden-1-one
InChIKey: SJNCSXMTBXDZQA-SECBINFHSA-N
SMILES: O=C1[C@H](C)CC2=C1C(C)=C(CCO)C(C)=C2
Biological Activity: Pterosin B is an orally active indanone. Pterosin B can be obtained from Pteridium aquilinum. Pterosin B is a Sik3 signaling inhibitor. Pterosin B inhibits Klf5 expression and reduces β-amyloid deposition. Pterosin B prevents chondrocyte hypertrophy and osteoarthritis in mice. Pterosin B inhibits cardiomyocyte hypertrophy, improves cognitive impairment, and lowers blood glucose. Pterosin B can be used in research on arthritis, Alzheimer's disease, pathological cardiac hypertrophy and diabetes[1][2][3][4][5].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Pterosin B | 99.98% | Pterosin B is an orally active indanone. Pterosin B can be obtained from Pteridium aquilinum. Pterosin B is a Sik3 signaling inhibitor. Pterosin B inhibits Klf5 expression and reduces β-amyloid deposition. Pterosin B prevents chondrocyte hypertrophy and osteoarthritis in mice. Pterosin B inhibits cardiomyocyte hypertrophy, improves cognitive impairment, and lowers blood glucose. Pterosin B can be used in research on arthritis, Alzheimer's disease, pathological cardiac hypertrophy and diabetes. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Pterosin B (Standard) | ≥98% | Pterosin B (Standard) is the analytical standard of Pterosin B (HY-N1570). This product is intended for research and analytical applications. Pterosin B is an indanone. Pterosin B can be obtained from Pteridium aquilinum. Pterosin B is a Sik3 signaling inhibitor. Pterosin B inhibits Klf5 expression and reduces β-amyloid deposition. Pterosin B prevents chondrocyte hypertrophy and osteoarthritis in mice. Pterosin B inhibits cardiomyocyte hypertrophy, improves cognitive impairment, and lowers blood glucose. Pterosin B can be used in research on arthritis, Alzheimer's disease, pathological cardiac hypertrophy and diabetes. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Hannah R.Dexter, et al. A concise stereoselective synthesis of pterosin B. Tetrahedron Letters, Volume 59, Issue 49, 5 December 2018, Pages 4323-4325.
- [2]. Yahara Y, et al. Pterosin B prevents chondrocyte hypertrophy and osteoarthritis in mice by inhibiting Sik3. Nat Commun. 2016 Mar 24;7:10959. [Content Brief]
- [3]. Lee C Y, et al. Novel therapeutic effects of pterosin B on Ang II-induced cardiomyocyte hypertrophy. Molecules, 2020, 25(22): 5279.
- [4]. Zhang Y, et al. Pterosin B improves cognitive dysfunction by promoting microglia M1/M2 polarization through inhibiting Klf5/Parp14 pathway. Phytomedicine. 2024 Dec;135:156152. [Content Brief]
- [5]. Itoh Y. Pterosin B, ingredient in Pteridium aquilinum, regulates hepatic gluconeogenesis via SIK3-dependent and independent mechanisms. 2017.
Keywords
