3520-43-2
Chemical Structure
JC-1
Synonym(s): CBIC2
- CAS No.: 3520-43-2
- Formula:C25H27Cl4IN4
- Molecular Weight:652.23
IUPAC Name: (E)-5,6-dichloro-2-(3-(5,6-dichloro-1,3-diethyl-1,3-dihydro-2H-benzo[d]imidazol-2-ylidene)prop-1-en-1-yl)-1,3-diethyl-1H-benzo[d]imidazol-3-ium iodide
InChIKey: FYNNIUVBDKICAX-UHFFFAOYSA-M
SMILES: ClC1=C(Cl)C=C([N+](CC)=C(/C=C/C=C2N(C(C=C(Cl)C(Cl)=C3)=C3N\2CC)CC)N4CC)C4=C1.[I-]
Biological Activity: JC-1 (CBIC2) is an ideal fluorescent probe widely used to detect mitochondrial membrane potential. JC-1 accumulates in mitochondria in a potential dependent manner and can be used to detect the membrane potential of cells or purified mitochondria. In normal mitochondria, JC-1 aggregates in the mitochondrial matrix to form a polymer, which emits strong red fluorescence (Ex=585 nm, Em=590 nm); When the mitochondrial membrane potential is low, JC-1 cannot aggregate in the matrix of mitochondria and produce green fluorescence (ex=510 nm, em= 527 nm)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
JC-1 | 98.05% | JC-1 (CBIC2) is an ideal fluorescent probe widely used to detect mitochondrial membrane potential. JC-1 accumulates in mitochondria in a potential dependent manner and can be used to detect the membrane potential of cells or purified mitochondria. In normal mitochondria, JC-1 aggregates in the mitochondrial matrix to form a polymer, which emits strong red fluorescence (Ex=585 nm, Em=590 nm); When the mitochondrial membrane potential is low, JC-1 cannot aggregate in the matrix of mitochondria and produce green fluorescence (ex=510 nm, em= 527 nm). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
JC-1 (solution) | JC-1 (CBIC2) (solution) is an ideal fluorescent probe widely used to detect mitochondrial membrane potential. JC-1 accumulates in mitochondria in a potential dependent manner and can be used to detect the membrane potential of cells, tissues or purified mitochondria. In normal mitochondria, JC-1 aggregates in the mitochondrial matrix to form a polymer, which emits strong red fluorescence (Ex=585 nm, Em=590 nm) ; When the mitochondrial membrane potential is low, JC-1 cannot aggregate in the matrix of mitochondria and produce green fluorescence (ex=510 nm, em= 527 nm) . Solvent and concentration: DMSO: 1.5 mM |
|||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
