36148-89-7
Chemical Structure
Amphotericin B methyl ester
- CAS No.: 36148-89-7
- Formula:C48H75NO17
- Molecular Weight:938.11
IUPAC Name: methyl (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-(((2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]no
InChIKey: UAZIZEMIKKIBCA-TYVGYKFWSA-N
SMILES: COC([C@H]1[C@@]2([H])O[C@](O)(C[C@H](C[C@H]([C@@H](CC[C@H](C[C@H](CC(O[C@H]([C@@H]([C@H](O)[C@@H](C)/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](O[C@@]3([H])[C@H]([C@H]([C@H](O)[C@@H](C)O3)N)O)C2)C)C)=O)O)O)O)O)O)C[C@@H]1O)=O
Biological Activity: Amphotericin B methyl ester is the methyl ester derivative of the polyene antibiotic Amphotericin B (A634250). Amphotericin B methyl ester is the cholesterol-binding compound possesses significant antifungal activity. Amphotericin B methyl ester disrupts HIV-1 particle production and potently inhibits HIV-1 replication[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Amphotericin B methyl ester | 83.37% | Amphotericin B methyl ester is the methyl ester derivative of the polyene antibiotic Amphotericin B (A634250). Amphotericin B methyl ester is the cholesterol-binding compound possesses significant antifungal activity. Amphotericin B methyl ester disrupts HIV-1 particle production and potently inhibits HIV-1 replication. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
- [1]. Waheed AA, et al. Inhibition of human immunodeficiency virus type 1 assembly and release by the cholesterol-binding compound amphotericin B methyl ester: evidence for Vpu dependence. J Virol. 2008 Oct;82(19):9776-81. [Content Brief]
- [2]. Keim GR, et al. Comparative toxicological studies of amphotericin B methyl ester and amphotericin B in mice, rats, and dogs. ntimicrob Agents Chemother. 1976 Oct;10(4):687-90. [Content Brief]