446-72-0
Chemical Structure
Genistein
Synonym(s): NPI 031L
- CAS No.: 446-72-0
- Formula:C15H10O5
- Molecular Weight:270.24
IUPAC Name: 5,7-dihydroxy-3-(4-hydroxyphenyl)-4H-chromen-4-one
InChIKey: TZBJGXHYKVUXJN-UHFFFAOYSA-N
SMILES: OC1=C2C(OC=C(C3=CC=C(O)C=C3)C2=O)=CC(O)=C1
Biological Activity: Genistein, a soy isoflavone, is a multiple tyrosine kinases (e.g., EGFR) inhibitor which acts as a chemotherapeutic agent against different types of cancer, mainly by altering apoptosis, the cell cycle, and angiogenesis and inhibiting metastasis.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Genistein | 99.82% | Genistein, a soy isoflavone, is a multiple tyrosine kinases (e.g., EGFR) inhibitor which acts as a chemotherapeutic agent against different types of cancer, mainly by altering apoptosis, the cell cycle, and angiogenesis and inhibiting metastasis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Genistein (Standard) | 98.70% | Genistein (Standard) is the analytical standard of Genistein. This product is intended for research and analytical applications. Genistein, a soy isoflavone, is a multiple tyrosine kinases (e.g., EGFR) inhibitor which acts as a chemotherapeutic agent against different types of cancer, mainly by altering apoptosis, the cell cycle, and angiogenesis and inhibiting metastasis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Genistein-d4 | 98.81% | Genistein-d4 is the deuterium labeled Genistein. Genistein, a soy isoflavone, is a multiple tyrosine kinases (e.g., EGFR) inhibitor which acts as a chemotherapeutic agent against different types of cancer, mainly by altering apoptosis, the cell cycle, and angiogenesis and inhibiting metastasis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||