521979-59-9
Chemical Structure
LMD-902
- CAS No.: 521979-59-9
- Formula:C28H34N2O6S
- Molecular Weight:526.64
SMILES: O=S(NCC)(C1=CC=C(C=C1C2(CCN(CC2)CC3=CC(OC4=C(OC)C=CC=C4)=CC=C3)O)OC)=O
Biological Activity: LMD-902, a LMD-009 (HY-121885) analog, is a CCR8 agonist with an EC50 of 15 nM. LMD-902 has a superior binging capacity depending on key residues such as PheVI:16. LMD-902 can be used for inflammation diseases like bronchial asthma and central nervous system diseases like multiple sclerosis research[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
LMD-902 | LMD-902, a LMD-009 (HY-121885) analog, is a CCR8 agonist with an EC50 of 15 nM. LMD-902 has a superior binging capacity depending on key residues such as PheVI:16. LMD-902 can be used for inflammation diseases like bronchial asthma and central nervous system diseases like multiple sclerosis research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||