52886-37-0
Chemical Structure
Deoxycholic acid-13C
Synonym(s): Cholanoic Acid-13C;Desoxycholic acid-13C
- CAS No.: 52886-37-0
- Formula:C2313CH40O4
- Molecular Weight:393.56
IUPAC Name: (R)-4-((3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic-1-13C acid
InChIKey: KXGVEGMKQFWNSR-JJUQXLBJSA-N
SMILES: C[C@@]12[C@](CC[C@]2([H])[C@H](C)CC[13C](O)=O)([H])[C@@]3([H])[C@@](C[C@@H]1O)([H])[C@@]4([C@](C[C@@H](CC4)O)([H])CC3)C
Biological Activity: Deoxycholic acid-13C is the 13C-labeled Deoxycholic acid. Deoxycholic acid is specifically responsible for activating the G protein-coupled bile acid receptor TGR5 that stimulates brown adipose tissue (BAT) thermogenic activity.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Deoxycholic acid-13C | 98.0% | Deoxycholic acid-13C is the 13C-labeled Deoxycholic acid. Deoxycholic acid is specifically responsible for activating the G protein-coupled bile acid receptor TGR5 that stimulates brown adipose tissue (BAT) thermogenic activity. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Deoxycholic acid (Standard) | 99.85% | Deoxycholic acid (Standard) is the analytical standard of Deoxycholic acid. This product is intended for research and analytical applications. Deoxycholic acid (cholanoic acid), a bile acid, is a by-product of intestinal metabolism, that activates the G protein-coupled bile acid receptorTGR5. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Deoxycholic acid-d5 | 99.9% | Deoxycholic acid-d5 is the deuterium labeled Deoxycholic acid. Deoxycholic acid is specifically responsible for activating the G protein-coupled bile acid receptor TGR5 that stimulates brown adipose tissue (BAT) thermogenic activity. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Deoxycholic acid-d4 | 99.80% | Deoxycholic acid-d4 is the deuterium labeled Deoxycholic acid. Deoxycholic acid is specifically responsible for activating the G protein-coupled bile acid receptor TGR5 that stimulates brown adipose tissue (BAT) thermogenic activity. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Deoxycholic acid-d6 | 99.70% | Deoxycholic acid-d6 is the deuterium labeled Deoxycholic acid. Deoxycholic acid is specifically responsible for activating the G protein-coupled bile acid receptor TGR5 that stimulates brown adipose tissue (BAT) thermogenic activity. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Deoxycholic acid | 99.94% | Deoxycholic acid (cholanoic acid), a bile acid, is a by-product of intestinal metabolism, that activates the G protein-coupled bile acid receptorTGR5. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
