5471-63-6
Chemical Structure
1,3-Diphenylisobenzofuran
Synonym(s): DPBF
- CAS No.: 5471-63-6
- Formula:C20H14O
- Molecular Weight:270.33
IUPAC Name: 1,3-diphenylisobenzofuran
InChIKey: ZKSVYBRJSMBDMV-UHFFFAOYSA-N
SMILES: C1(C2=CC=CC=C2)=C3C=CC=CC3=C(C4=CC=CC=C4)O1
Biological Activity: 1,3-Diphenylisobenzofuran (DPBF) has been developed as a selective probe for the detection and quantitative determination of hydrogen peroxide in samples containing different reactive nitrogen and oxygen species (RNOS). DPBF is a fluorescent probe which, for almost 20 years, was believed to react in a highly specific manner toward some reactive oxygen species such as singlet oxygen and hydroxy, alkyloxy or alkylperoxy radicals[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
1,3-Diphenylisobenzofuran | 98.90% | 1,3-Diphenylisobenzofuran (DPBF) has been developed as a selective probe for the detection and quantitative determination of hydrogen peroxide in samples containing different reactive nitrogen and oxygen species (RNOS). DPBF is a fluorescent probe which, for almost 20 years, was believed to react in a highly specific manner toward some reactive oxygen species such as singlet oxygen and hydroxy, alkyloxy or alkylperoxy radicals. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
1,3-Diphenylisobenzofuran (solution) | 1,3-Diphenylisobenzofuran (DPBF) (solution) has been developed as a selective probe for the detection and quantitative determination of hydrogen peroxide in samples containing different reactive nitrogen and oxygen species (RNOS). DPBF is a fluorescent probe which, for almost 20 years, was believed to react in a highly specific manner toward some reactive oxygen species such as singlet oxygen and hydroxy, alkyloxy or alkylperoxy radicals. Solvent and concentration: DMSO: 10 mM The 1 mL volume is defined as the base specification. All larger sizes correspond to incremental volumes of this base. |
|||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
