565450-82-0
Chemical Structure
3’-β-C-Ethynyl-N6,N6-dimethyladenosine
- CAS No.: 565450-82-0
- Formula:C14H17N5O4
- Molecular Weight:319.32
IUPAC Name: (2R,3S,4R,5R)-5-(6-(dimethylamino)-9H-purin-9-yl)-3-ethynyl-2-(hydroxymethyl)tetrahydrofuran-3,4-diol
InChIKey: LGCSVJHSDHLJRH-ZLBRTTDGSA-N
SMILES: OC[C@@H]1[C@](O)(C#C)[C@@H](O)[C@H](N2C=NC3=C2N=CN=C3N(C)C)O1
Biological Activity: 3’-β-C-Ethynyl-N6,N6-dimethyladenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. 3’-β-C-Ethynyl-N6,N6-dimethyladenosine is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
3’-β-C-Ethynyl-N6,N6-dimethyladenosine | 3’-β-C-Ethynyl-N6,N6-dimethyladenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277). 3’-β-C-Ethynyl-N6,N6-dimethyladenosine is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
