58-68-4
Chemical Structure
NADH
- CAS No.: 58-68-4
- Formula:C21H29N7O14P2
- Molecular Weight:665.44
InChIKey: BOPGDPNILDQYTO-NNYOXOHSSA-N
SMILES: O[C@H]1[C@@H](O)[C@H](N2C=CCC(C(N)=O)=C2)O[C@@H]1COP(O)(OP(OC[C@@H]3[C@@H](O)[C@@H](O)[C@H](N4C5=NC=NC(N)=C5N=C4)O3)(O)=O)=O
Biological Activity: NADH is an orally active dehydrogenase coenzyme that acts as a crucial electron carrier in cellular respiration and participates in ATP production. NADH promotes metabolism, supports brain function, and counteracts oxidative stress by transferring electrons to the electron transport chain. As a signaling molecule, NADH regulates multiple biological processes, including anti-apoptosis, synaptic plasticity, gene expression, and calcium homeostasis. Redox imbalance of NADH/NAD⁺ is one of the key pathological mechanisms of various diseases, such as diabetic nephropathy, neurodegenerative diseases, and ischemia-reperfusion injury.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
NADH | NADH is an orally active dehydrogenase coenzyme that acts as a crucial electron carrier in cellular respiration and participates in ATP production. NADH promotes metabolism, supports brain function, and counteracts oxidative stress by transferring electrons to the electron transport chain. As a signaling molecule, NADH regulates multiple biological processes, including anti-apoptosis, synaptic plasticity, gene expression, and calcium homeostasis. Redox imbalance of NADH/NAD⁺ is one of the key pathological mechanisms of various diseases, such as diabetic nephropathy, neurodegenerative diseases, and ischemia-reperfusion injury. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||